C17H16N4O2S — CID 1481228
1-(3-methylphenyl)-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]urea (PubChem CID 1481228) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]urea.
| Compound Name | 1-(3-methylphenyl)-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]urea |
|---|---|
| PubChem CID | 1481228 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(3-pyrrol-1-ylthiophene-2-carbonyl)amino]urea |
| SMILES | Cc1cccc(NC(=O)NNC(=O)c2sccc2-n2cccc2)c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-12-5-4-6-13(11-12)18-17(23)20-19-16(22)15-14(7-10-24-15)21-8-2-3-9-21/h2-11H,1H3,(H,19,22)(H2,18,20,23) |
| InChIKey | CGVYPOMGMBYPRY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|