C18H27N7O8 — CID 14812400
3-O,4-O-diethyl 3a-O-methyl 6a-amino-1,6-bis(carbamoylamino)-2,5-dimethylpyrrolo[2,3-b]pyrrole-3,3a,4-tricarboxylate (PubChem CID 14812400) has the molecular formula C18H27N7O8 and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-O,4-O-diethyl 3a-O-methyl 6a-amino-1,6-bis(carbamoylamino)-2,5-dimethylpyrrolo[2,3-b]pyrrole-3,3a,4-tricarboxylate.
| Compound Name | 3-O,4-O-diethyl 3a-O-methyl 6a-amino-1,6-bis(carbamoylamino)-2,5-dimethylpyrrolo[2,3-b]pyrrole-3,3a,4-tricarboxylate |
|---|---|
| PubChem CID | 14812400 |
| Molecular Formula | C18H27N7O8 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 3-O,4-O-diethyl 3a-O-methyl 6a-amino-1,6-bis(carbamoylamino)-2,5-dimethylpyrrolo[2,3-b]pyrrole-3,3a,4-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(NC(N)=O)C2(N)N(NC(N)=O)C(C)=C(C(=O)OCC)C12C(=O)OC |
| InChI | InChI=1S/C18H27N7O8/c1-6-32-12(26)10-8(3)24(22-15(19)29)18(21)17(10,14(28)31-5)11(13(27)33-7-2)9(4)25(18)23-16(20)30/h6-7,21H2,1-5H3,(H3,19,22,29)(H3,20,23,30) |
| InChIKey | NFAAQYWWRLAAMC-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 221.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|