C19H14N2 — CID 14812683
2,20-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,16(21),17,19-nonaene (PubChem CID 14812683) has the molecular formula C19H14N2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2,20-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,16(21),17,19-nonaene.
| Compound Name | 2,20-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,16(21),17,19-nonaene |
|---|---|
| PubChem CID | 14812683 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2,20-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,16(21),17,19-nonaene |
| SMILES | c1ccc2c(c1)Cc1cc3c(nc1-2)-c1ncccc1CC3 |
| InChI | InChI=1S/C19H14N2/c1-2-6-16-13(4-1)10-15-11-14-8-7-12-5-3-9-20-18(12)19(14)21-17(15)16/h1-6,9,11H,7-8,10H2 |
| InChIKey | TVEGGLWHUDAIQZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |