About 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one
4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one (PubChem CID 14813453) has the molecular formula C11H16O2Si
and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
| PubChem CID | 14813453 |
| Molecular Formula | C11H16O2Si |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one |
| SMILES | CC1=C(C)C(O)(C#C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C11H16O2Si/c1-8-9(2)11(13,10(8)12)6-7-14(3,4)5/h13H,1-5H3 |
| InChIKey | XOPHRXXSYGSMTN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one?
The IUPAC name of 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one (CID 14813453) is 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one.
What is the SMILES notation for 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one?
The canonical SMILES for 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one is CC1=C(C)C(O)(C#C[Si](C)(C)C)C1=O.
What is the InChIKey of 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one?
The InChIKey is XOPHRXXSYGSMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2Si/c1-8-9(2)11(13,10(8)12)6-7-14(3,4)5/h13H,1-5H3.
What are the key properties of 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one?
4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one has a molecular weight of 208.33 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dimethyl-4-(2-trimethylsilylethynyl)cyclobut-2-en-1-one is sourced from PubChem (CID 14813453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).