C11H13ClO3 — CID 14813833
1-(4-chlorophenyl)-1,3-dimethoxypropan-2-one (PubChem CID 14813833) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1,3-dimethoxypropan-2-one.
| Compound Name | 1-(4-chlorophenyl)-1,3-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 14813833 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(4-chlorophenyl)-1,3-dimethoxypropan-2-one |
| SMILES | COCC(=O)C(OC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClO3/c1-14-7-10(13)11(15-2)8-3-5-9(12)6-4-8/h3-6,11H,7H2,1-2H3 |
| InChIKey | QOGDABCUTCYEML-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |