C14H28O6 — CID 14814457
2,3-dimethyl-1,4,7,10,13,16-hexaoxacyclooctadecane (PubChem CID 14814457) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is 2,3-dimethyl-1,4,7,10,13,16-hexaoxacyclooctadecane.
| Compound Name | 2,3-dimethyl-1,4,7,10,13,16-hexaoxacyclooctadecane |
|---|---|
| PubChem CID | 14814457 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2,3-dimethyl-1,4,7,10,13,16-hexaoxacyclooctadecane |
| SMILES | CC1OCCOCCOCCOCCOCCOC1C |
| InChI | InChI=1S/C14H28O6/c1-13-14(2)20-12-10-18-8-6-16-4-3-15-5-7-17-9-11-19-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | FVEKHJSHKZYORD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |