About 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine
4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine (PubChem CID 14814702) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine |
| PubChem CID | 14814702 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine |
| SMILES | COCc1cc(-c2csc(N)n2)on1 |
| InChI | InChI=1S/C8H9N3O2S/c1-12-3-5-2-7(13-11-5)6-4-14-8(9)10-6/h2,4H,3H2,1H3,(H2,9,10) |
| InChIKey | UOABNPCWZWUCSN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine (CID 14814702) is 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine is COCc1cc(-c2csc(N)n2)on1.
What is the InChIKey of 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine?
The InChIKey is UOABNPCWZWUCSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c1-12-3-5-2-7(13-11-5)6-4-14-8(9)10-6/h2,4H,3H2,1H3,(H2,9,10).
What are the key properties of 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine?
4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine has a molecular weight of 211.25 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(methoxymethyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine is sourced from PubChem (CID 14814702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).