About [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol
[3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol (PubChem CID 14814711) has the molecular formula C7H7N3O2S
and a molecular weight of 197.22 g/mol. Its IUPAC name is [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol |
| PubChem CID | 14814711 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol |
| SMILES | Nc1nc(-c2cc(CO)on2)cs1 |
| InChI | InChI=1S/C7H7N3O2S/c8-7-9-6(3-13-7)5-1-4(2-11)12-10-5/h1,3,11H,2H2,(H2,8,9) |
| InChIKey | HHSUWMSPSPOGNR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol (CID 14814711) is [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol is Nc1nc(-c2cc(CO)on2)cs1.
What is the InChIKey of [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol?
The InChIKey is HHSUWMSPSPOGNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S/c8-7-9-6(3-13-7)5-1-4(2-11)12-10-5/h1,3,11H,2H2,(H2,8,9).
What are the key properties of [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol?
[3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol has a molecular weight of 197.22 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-amino-1,3-thiazol-4-yl)-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 14814711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).