About 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide
1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 1481479) has the molecular formula C18H21N3O2S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| PubChem CID | 1481479 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(Cc2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(19-20-18(23)16-7-4-12-24-16)15-8-10-21(11-9-15)13-14-5-2-1-3-6-14/h1-7,12,15H,8-11,13H2,(H,19,22)(H,20,23) |
| InChIKey | JDASVOYLBUGEDX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
The IUPAC name of 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide (CID 1481479) is 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide.
What is the SMILES notation for 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
The canonical SMILES for 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide is O=C(NNC(=O)C1CCN(Cc2ccccc2)CC1)c1cccs1.
What is the InChIKey of 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
The InChIKey is JDASVOYLBUGEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2S/c22-17(19-20-18(23)16-7-4-12-24-16)15-8-10-21(11-9-15)13-14-5-2-1-3-6-14/h1-7,12,15H,8-11,13H2,(H,19,22)(H,20,23).
What are the key properties of 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide?
1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide has a molecular weight of 343.45 g/mol, XLogP of 2.42, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N'-(thiophene-2-carbonyl)piperidine-4-carbohydrazide is sourced from PubChem (CID 1481479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).