C10H19N3 — CID 14814944
(6S)-8-azido-2,6-dimethyloct-2-ene (PubChem CID 14814944) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (6S)-8-azido-2,6-dimethyloct-2-ene.
| Compound Name | (6S)-8-azido-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 14814944 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (6S)-8-azido-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCC[C@H](C)CCN=[N+]=[N-] |
| InChI | InChI=1S/C10H19N3/c1-9(2)5-4-6-10(3)7-8-12-13-11/h5,10H,4,6-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | YSRHILCAYSDFSB-JTQLQIEISA-N |
| XLogP | 4.07 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|