2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid

C15H12N2O3 — CID 14815129

IUPAC2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid
SMILESO=C(O)CC1c2cccnc2C(=O)N1c1ccccc1
InChIInChI=1S/C15H12N2O3/c18-13(19)9-12-11-7-4-8-16-14(11)15(20)17(12)10-5-2-1-3-6-10/h1-8,12H,9H2,(H,18,19)
InChIKeyBSDJDIBYQROOBR-UHFFFAOYSA-N
MW268.27 g/mol
LogP2.26
Rot. Bonds3

About 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid

2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid (PubChem CID 14815129) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid
PubChem CID14815129
Molecular FormulaC15H12N2O3
Molecular Weight268.27 g/mol
Exact Mass268.08
IUPAC Name2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid
SMILESO=C(O)CC1c2cccnc2C(=O)N1c1ccccc1
InChIInChI=1S/C15H12N2O3/c18-13(19)9-12-11-7-4-8-16-14(11)15(20)17(12)10-5-2-1-3-6-10/h1-8,12H,9H2,(H,18,19)
InChIKeyBSDJDIBYQROOBR-UHFFFAOYSA-N
XLogP2.26
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid?
The IUPAC name of 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid (CID 14815129) is 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid.
What is the SMILES notation for 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid?
The canonical SMILES for 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid is O=C(O)CC1c2cccnc2C(=O)N1c1ccccc1.
What is the InChIKey of 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid?
The InChIKey is BSDJDIBYQROOBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c18-13(19)9-12-11-7-4-8-16-14(11)15(20)17(12)10-5-2-1-3-6-10/h1-8,12H,9H2,(H,18,19).
What are the key properties of 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid?
2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid has a molecular weight of 268.27 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-oxo-6-phenyl-5H-pyrrolo[3,4-b]pyridin-5-yl)acetic acid is sourced from PubChem (CID 14815129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).