About 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]
2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] (PubChem CID 14815239) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole].
Molecular Properties
| Compound Name | 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] |
| PubChem CID | 14815239 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] |
| SMILES | c1ccc2c(c1)c(C1=NCC3(CN4CCC3CC4)O1)cn2CC1CC1 |
| InChI | InChI=1S/C21H25N3O/c1-2-4-19-17(3-1)18(12-24(19)11-15-5-6-15)20-22-13-21(25-20)14-23-9-7-16(21)8-10-23/h1-4,12,15-16H,5-11,13-14H2 |
| InChIKey | BESMUVURBIHFQF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]?
The IUPAC name of 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] (CID 14815239) is 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole].
What is the SMILES notation for 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]?
The canonical SMILES for 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] is c1ccc2c(c1)c(C1=NCC3(CN4CCC3CC4)O1)cn2CC1CC1.
What is the InChIKey of 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]?
The InChIKey is BESMUVURBIHFQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O/c1-2-4-19-17(3-1)18(12-24(19)11-15-5-6-15)20-22-13-21(25-20)14-23-9-7-16(21)8-10-23/h1-4,12,15-16H,5-11,13-14H2.
What are the key properties of 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]?
2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] has a molecular weight of 335.45 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-[1-(cyclopropylmethyl)indol-3-yl]spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] is sourced from PubChem (CID 14815239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).