About (E)-3-methylhept-5-enal
(E)-3-methylhept-5-enal (PubChem CID 14815833) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (E)-3-methylhept-5-enal.
Molecular Properties
| Compound Name | (E)-3-methylhept-5-enal |
| PubChem CID | 14815833 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (E)-3-methylhept-5-enal |
| SMILES | C/C=C/CC(C)CC=O |
| InChI | InChI=1S/C8H14O/c1-3-4-5-8(2)6-7-9/h3-4,7-8H,5-6H2,1-2H3/b4-3+ |
| InChIKey | QMWZRDVXXPKGTD-ONEGZZNKSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methylhept-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methylhept-5-enal?
The IUPAC name of (E)-3-methylhept-5-enal (CID 14815833) is (E)-3-methylhept-5-enal.
What is the SMILES notation for (E)-3-methylhept-5-enal?
The canonical SMILES for (E)-3-methylhept-5-enal is C/C=C/CC(C)CC=O.
What is the InChIKey of (E)-3-methylhept-5-enal?
The InChIKey is QMWZRDVXXPKGTD-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H14O/c1-3-4-5-8(2)6-7-9/h3-4,7-8H,5-6H2,1-2H3/b4-3+.
What are the key properties of (E)-3-methylhept-5-enal?
(E)-3-methylhept-5-enal has a molecular weight of 126.20 g/mol, XLogP of 2.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methylhept-5-enal is sourced from PubChem (CID 14815833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).