C12H18N4O2 — CID 14816049
1-hydroxy-2-[(E)-2-(2,4,6-trimethylphenoxy)ethylideneamino]guanidine (PubChem CID 14816049) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-2-(2,4,6-trimethylphenoxy)ethylideneamino]guanidine.
| Compound Name | 1-hydroxy-2-[(E)-2-(2,4,6-trimethylphenoxy)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 14816049 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-hydroxy-2-[(E)-2-(2,4,6-trimethylphenoxy)ethylideneamino]guanidine |
| SMILES | Cc1cc(C)c(OC/C=N/N=C(\N)NO)c(C)c1 |
| InChI | InChI=1S/C12H18N4O2/c1-8-6-9(2)11(10(3)7-8)18-5-4-14-15-12(13)16-17/h4,6-7,17H,5H2,1-3H3,(H3,13,15,16)/b14-4+ |
| InChIKey | BWBXZQXPVFNLTK-LNKIKWGQSA-N |
| XLogP | 1.27 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|