About 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde
2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde (PubChem CID 1481617) has the molecular formula C17H11Cl2NOS
and a molecular weight of 348.25 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde |
| PubChem CID | 1481617 |
| Molecular Formula | C17H11Cl2NOS |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde |
| SMILES | O=Cc1cc2ccccc2nc1SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2NOS/c18-14-6-5-11(7-15(14)19)10-22-17-13(9-21)8-12-3-1-2-4-16(12)20-17/h1-9H,10H2 |
| InChIKey | GSWVSCLPMUCKTL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde?
The IUPAC name of 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde (CID 1481617) is 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde?
The canonical SMILES for 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde is O=Cc1cc2ccccc2nc1SCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde?
The InChIKey is GSWVSCLPMUCKTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2NOS/c18-14-6-5-11(7-15(14)19)10-22-17-13(9-21)8-12-3-1-2-4-16(12)20-17/h1-9H,10H2.
What are the key properties of 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde?
2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde has a molecular weight of 348.25 g/mol, XLogP of 5.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)methylsulfanyl]quinoline-3-carbaldehyde is sourced from PubChem (CID 1481617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).