About 4-(hexoxymethyl)phenol
4-(hexoxymethyl)phenol (PubChem CID 14816980) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(hexoxymethyl)phenol.
Molecular Properties
| Compound Name | 4-(hexoxymethyl)phenol |
| PubChem CID | 14816980 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-(hexoxymethyl)phenol |
| SMILES | CCCCCCOCc1ccc(O)cc1 |
| InChI | InChI=1S/C13H20O2/c1-2-3-4-5-10-15-11-12-6-8-13(14)9-7-12/h6-9,14H,2-5,10-11H2,1H3 |
| InChIKey | GZJVLYHCWVPVCM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(hexoxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hexoxymethyl)phenol?
The IUPAC name of 4-(hexoxymethyl)phenol (CID 14816980) is 4-(hexoxymethyl)phenol.
What is the SMILES notation for 4-(hexoxymethyl)phenol?
The canonical SMILES for 4-(hexoxymethyl)phenol is CCCCCCOCc1ccc(O)cc1.
What is the InChIKey of 4-(hexoxymethyl)phenol?
The InChIKey is GZJVLYHCWVPVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-2-3-4-5-10-15-11-12-6-8-13(14)9-7-12/h6-9,14H,2-5,10-11H2,1H3.
What are the key properties of 4-(hexoxymethyl)phenol?
4-(hexoxymethyl)phenol has a molecular weight of 208.30 g/mol, XLogP of 3.49, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hexoxymethyl)phenol is sourced from PubChem (CID 14816980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).