C16H28N2O2Si — CID 14817759
5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 14817759) has the molecular formula C16H28N2O2Si and a molecular weight of 308.50 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 14817759 |
| Molecular Formula | C16H28N2O2Si |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC2C(=O)C(=[N+]=[N-])CCC12 |
| InChI | InChI=1S/C16H28N2O2Si/c1-16(2,3)21(4,5)20-14-8-6-7-12-11(14)9-10-13(18-17)15(12)19/h11-12,14H,6-10H2,1-5H3 |
| InChIKey | RMCFSPBCWIFWOV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|