About 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane
3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane (PubChem CID 14817848) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane.
Molecular Properties
| Compound Name | 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane |
| PubChem CID | 14817848 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane |
| SMILES | CCOC(C)(OCC)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C14H28O2/c1-6-15-14(5,16-7-2)12-9-8-10-13(3,4)11-12/h12H,6-11H2,1-5H3 |
| InChIKey | QJTDNTNGXHWUNK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane?
The IUPAC name of 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane (CID 14817848) is 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane.
What is the SMILES notation for 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane?
The canonical SMILES for 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane is CCOC(C)(OCC)C1CCCC(C)(C)C1.
What is the InChIKey of 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane?
The InChIKey is QJTDNTNGXHWUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-6-15-14(5,16-7-2)12-9-8-10-13(3,4)11-12/h12H,6-11H2,1-5H3.
What are the key properties of 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane?
3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane has a molecular weight of 228.38 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-diethoxyethyl)-1,1-dimethylcyclohexane is sourced from PubChem (CID 14817848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).