About 2,3,6-trimethylbenzenethiol
2,3,6-trimethylbenzenethiol (PubChem CID 14818729) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is 2,3,6-trimethylbenzenethiol.
Molecular Properties
| Compound Name | 2,3,6-trimethylbenzenethiol |
| PubChem CID | 14818729 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 2,3,6-trimethylbenzenethiol |
| SMILES | Cc1ccc(C)c(S)c1C |
| InChI | InChI=1S/C9H12S/c1-6-4-5-7(2)9(10)8(6)3/h4-5,10H,1-3H3 |
| InChIKey | XVSJTVAPLGSCSK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6-trimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethylbenzenethiol?
The IUPAC name of 2,3,6-trimethylbenzenethiol (CID 14818729) is 2,3,6-trimethylbenzenethiol.
What is the SMILES notation for 2,3,6-trimethylbenzenethiol?
The canonical SMILES for 2,3,6-trimethylbenzenethiol is Cc1ccc(C)c(S)c1C.
What is the InChIKey of 2,3,6-trimethylbenzenethiol?
The InChIKey is XVSJTVAPLGSCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S/c1-6-4-5-7(2)9(10)8(6)3/h4-5,10H,1-3H3.
What are the key properties of 2,3,6-trimethylbenzenethiol?
2,3,6-trimethylbenzenethiol has a molecular weight of 152.26 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylbenzenethiol is sourced from PubChem (CID 14818729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).