About 1-hydroperoxypropan-1-ol
1-hydroperoxypropan-1-ol (PubChem CID 14819037) has the molecular formula C3H8O3
and a molecular weight of 92.09 g/mol. Its IUPAC name is 1-hydroperoxypropan-1-ol.
Molecular Properties
| Compound Name | 1-hydroperoxypropan-1-ol |
| PubChem CID | 14819037 |
| Molecular Formula | C3H8O3 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.05 |
| IUPAC Name | 1-hydroperoxypropan-1-ol |
| SMILES | CCC(O)OO |
| InChI | InChI=1S/C3H8O3/c1-2-3(4)6-5/h3-5H,2H2,1H3 |
| InChIKey | RIRTXIQGPQFACK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroperoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroperoxypropan-1-ol?
The IUPAC name of 1-hydroperoxypropan-1-ol (CID 14819037) is 1-hydroperoxypropan-1-ol.
What is the SMILES notation for 1-hydroperoxypropan-1-ol?
The canonical SMILES for 1-hydroperoxypropan-1-ol is CCC(O)OO.
What is the InChIKey of 1-hydroperoxypropan-1-ol?
The InChIKey is RIRTXIQGPQFACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3/c1-2-3(4)6-5/h3-5H,2H2,1H3.
What are the key properties of 1-hydroperoxypropan-1-ol?
1-hydroperoxypropan-1-ol has a molecular weight of 92.09 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroperoxypropan-1-ol is sourced from PubChem (CID 14819037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).