About 2-cyclohexyl-N'-hydroxyethanimidamide
2-cyclohexyl-N'-hydroxyethanimidamide (PubChem CID 14819359) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-cyclohexyl-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-N'-hydroxyethanimidamide |
| PubChem CID | 14819359 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-cyclohexyl-N'-hydroxyethanimidamide |
| SMILES | N/C(CC1CCCCC1)=N\O |
| InChI | InChI=1S/C8H16N2O/c9-8(10-11)6-7-4-2-1-3-5-7/h7,11H,1-6H2,(H2,9,10) |
| InChIKey | NGBKKVXCFFKISP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N'-hydroxyethanimidamide?
The IUPAC name of 2-cyclohexyl-N'-hydroxyethanimidamide (CID 14819359) is 2-cyclohexyl-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-cyclohexyl-N'-hydroxyethanimidamide?
The canonical SMILES for 2-cyclohexyl-N'-hydroxyethanimidamide is N/C(CC1CCCCC1)=N\O.
What is the InChIKey of 2-cyclohexyl-N'-hydroxyethanimidamide?
The InChIKey is NGBKKVXCFFKISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c9-8(10-11)6-7-4-2-1-3-5-7/h7,11H,1-6H2,(H2,9,10).
What are the key properties of 2-cyclohexyl-N'-hydroxyethanimidamide?
2-cyclohexyl-N'-hydroxyethanimidamide has a molecular weight of 156.23 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N'-hydroxyethanimidamide is sourced from PubChem (CID 14819359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).