About 2-pyridin-4-ylquinoline
2-pyridin-4-ylquinoline (PubChem CID 1481979) has the molecular formula C14H10N2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-pyridin-4-ylquinoline.
Molecular Properties
| Compound Name | 2-pyridin-4-ylquinoline |
| PubChem CID | 1481979 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-pyridin-4-ylquinoline |
| SMILES | c1ccc2nc(-c3ccncc3)ccc2c1 |
| InChI | InChI=1S/C14H10N2/c1-2-4-13-11(3-1)5-6-14(16-13)12-7-9-15-10-8-12/h1-10H |
| InChIKey | KTDMTKZWKXFJHS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-4-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-ylquinoline?
The IUPAC name of 2-pyridin-4-ylquinoline (CID 1481979) is 2-pyridin-4-ylquinoline.
What is the SMILES notation for 2-pyridin-4-ylquinoline?
The canonical SMILES for 2-pyridin-4-ylquinoline is c1ccc2nc(-c3ccncc3)ccc2c1.
What is the InChIKey of 2-pyridin-4-ylquinoline?
The InChIKey is KTDMTKZWKXFJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2/c1-2-4-13-11(3-1)5-6-14(16-13)12-7-9-15-10-8-12/h1-10H.
What are the key properties of 2-pyridin-4-ylquinoline?
2-pyridin-4-ylquinoline has a molecular weight of 206.25 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-ylquinoline is sourced from PubChem (CID 1481979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).