C5H2Cl2N4 — CID 1482346
3,6-dichloro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 1482346) has the molecular formula C5H2Cl2N4 and a molecular weight of 189.01 g/mol. Its IUPAC name is 3,6-dichloro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3,6-dichloro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 1482346 |
| Molecular Formula | C5H2Cl2N4 |
| Molecular Weight | 189.01 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 3,6-dichloro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Clc1ccc2nnc(Cl)n2n1 |
| InChI | InChI=1S/C5H2Cl2N4/c6-3-1-2-4-8-9-5(7)11(4)10-3/h1-2H |
| InChIKey | YHVQNULRPMZYEO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.01 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |