About 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol
4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol (PubChem CID 1482352) has the molecular formula C16H8F6N2O2
and a molecular weight of 374.24 g/mol. Its IUPAC name is 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol.
Molecular Properties
| Compound Name | 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol |
| PubChem CID | 1482352 |
| Molecular Formula | C16H8F6N2O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol |
| SMILES | Oc1ccc(Oc2ccc3c(C(F)(F)F)cc(C(F)(F)F)nc3n2)cc1 |
| InChI | InChI=1S/C16H8F6N2O2/c17-15(18,19)11-7-12(16(20,21)22)23-14-10(11)5-6-13(24-14)26-9-3-1-8(25)2-4-9/h1-7,25H |
| InChIKey | RQMBVQYGPRMKDV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol?
The IUPAC name of 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol (CID 1482352) is 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol.
What is the SMILES notation for 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol?
The canonical SMILES for 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol is Oc1ccc(Oc2ccc3c(C(F)(F)F)cc(C(F)(F)F)nc3n2)cc1.
What is the InChIKey of 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol?
The InChIKey is RQMBVQYGPRMKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F6N2O2/c17-15(18,19)11-7-12(16(20,21)22)23-14-10(11)5-6-13(24-14)26-9-3-1-8(25)2-4-9/h1-7,25H.
What are the key properties of 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol?
4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol has a molecular weight of 374.24 g/mol, XLogP of 5.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-yl]oxy]phenol is sourced from PubChem (CID 1482352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).