About diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate
diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 14823666) has the molecular formula C14H22O5
and a molecular weight of 270.32 g/mol. Its IUPAC name is diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 14823666 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1C(C(=O)OCC)C2(C)CCC1(C)O2 |
| InChI | InChI=1S/C14H22O5/c1-5-17-11(15)9-10(12(16)18-6-2)14(4)8-7-13(9,3)19-14/h9-10H,5-8H2,1-4H3 |
| InChIKey | GWMNBUIDHWMZMA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 14823666) is diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate is CCOC(=O)C1C(C(=O)OCC)C2(C)CCC1(C)O2.
What is the InChIKey of diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is GWMNBUIDHWMZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5/c1-5-17-11(15)9-10(12(16)18-6-2)14(4)8-7-13(9,3)19-14/h9-10H,5-8H2,1-4H3.
What are the key properties of diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 270.32 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1,4-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 14823666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).