About 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide
4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide (PubChem CID 1482390) has the molecular formula C13H11Cl2N3O
and a molecular weight of 296.16 g/mol. Its IUPAC name is 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide |
| PubChem CID | 1482390 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide |
| SMILES | CN(NC(=O)c1ccc(Cl)cc1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C13H11Cl2N3O/c1-18(12-4-2-3-11(15)16-12)17-13(19)9-5-7-10(14)8-6-9/h2-8H,1H3,(H,17,19) |
| InChIKey | CRAQKAYFXPOZLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide?
The IUPAC name of 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide (CID 1482390) is 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide.
What is the SMILES notation for 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide?
The canonical SMILES for 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide is CN(NC(=O)c1ccc(Cl)cc1)c1cccc(Cl)n1.
What is the InChIKey of 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide?
The InChIKey is CRAQKAYFXPOZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N3O/c1-18(12-4-2-3-11(15)16-12)17-13(19)9-5-7-10(14)8-6-9/h2-8H,1H3,(H,17,19).
What are the key properties of 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide?
4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide has a molecular weight of 296.16 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N'-(6-chloro-2-pyridinyl)-N'-methylbenzohydrazide is sourced from PubChem (CID 1482390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).