About 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one
6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 1482416) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 1482416 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CC(=O)c1cnc2n(c1=O)CCS2 |
| InChI | InChI=1S/C8H8N2O2S/c1-5(11)6-4-9-8-10(7(6)12)2-3-13-8/h4H,2-3H2,1H3 |
| InChIKey | QBCLJAGTRMZNDH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 1482416) is 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one is CC(=O)c1cnc2n(c1=O)CCS2.
What is the InChIKey of 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is QBCLJAGTRMZNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-5(11)6-4-9-8-10(7(6)12)2-3-13-8/h4H,2-3H2,1H3.
What are the key properties of 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 196.23 g/mol, XLogP of 0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 1482416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).