About N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide
N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide (PubChem CID 1482436) has the molecular formula C12H8ClF2N3O
and a molecular weight of 283.67 g/mol. Its IUPAC name is N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide |
| PubChem CID | 1482436 |
| Molecular Formula | C12H8ClF2N3O |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide |
| SMILES | O=C(NNc1cccc(Cl)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H8ClF2N3O/c13-9-5-2-6-10(16-9)17-18-12(19)11-7(14)3-1-4-8(11)15/h1-6H,(H,16,17)(H,18,19) |
| InChIKey | IWZFGZSUNIDJDG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide?
The IUPAC name of N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide (CID 1482436) is N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide.
What is the SMILES notation for N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide?
The canonical SMILES for N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide is O=C(NNc1cccc(Cl)n1)c1c(F)cccc1F.
What is the InChIKey of N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide?
The InChIKey is IWZFGZSUNIDJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClF2N3O/c13-9-5-2-6-10(16-9)17-18-12(19)11-7(14)3-1-4-8(11)15/h1-6H,(H,16,17)(H,18,19).
What are the key properties of N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide?
N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide has a molecular weight of 283.67 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-chloro-2-pyridinyl)-2,6-difluorobenzohydrazide is sourced from PubChem (CID 1482436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).