C15H24 — CID 14824984
(2E,4E,6E,8E)-7-ethyl-3,5-dimethylundeca-2,4,6,8-tetraene (PubChem CID 14824984) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (2E,4E,6E,8E)-7-ethyl-3,5-dimethylundeca-2,4,6,8-tetraene.
| Compound Name | (2E,4E,6E,8E)-7-ethyl-3,5-dimethylundeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 14824984 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (2E,4E,6E,8E)-7-ethyl-3,5-dimethylundeca-2,4,6,8-tetraene |
| SMILES | C/C=C(C)/C=C(C)/C=C(/C=C/CC)CC |
| InChI | InChI=1S/C15H24/c1-6-9-10-15(8-3)12-14(5)11-13(4)7-2/h7,9-12H,6,8H2,1-5H3/b10-9+,13-7+,14-11+,15-12+ |
| InChIKey | QKGBXJCVBMNDMR-VBPLKGSMSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|