C23H26O8S — CID 14824987
[2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 14824987) has the molecular formula C23H26O8S and a molecular weight of 462.52 g/mol. Its IUPAC name is [2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14824987 |
| Molecular Formula | C23H26O8S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [2-(2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)C2OC3OC(C)(C)OC3C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26O8S/c1-15-9-11-17(12-10-15)32(25,26)28-14-18(24)19-20(27-13-16-7-5-4-6-8-16)21-22(29-19)31-23(2,3)30-21/h4-12,19-22H,13-14H2,1-3H3 |
| InChIKey | XOOMEASEZMFPIJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|