About 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine
1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 14825379) has the molecular formula C8H11N5S
and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 14825379 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCn1ncc2c(N)nc(SC)nc21 |
| InChI | InChI=1S/C8H11N5S/c1-3-13-7-5(4-10-13)6(9)11-8(12-7)14-2/h4H,3H2,1-2H3,(H2,9,11,12) |
| InChIKey | FVJNUPWDRKLAJF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine (CID 14825379) is 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine is CCn1ncc2c(N)nc(SC)nc21.
What is the InChIKey of 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is FVJNUPWDRKLAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5S/c1-3-13-7-5(4-10-13)6(9)11-8(12-7)14-2/h4H,3H2,1-2H3,(H2,9,11,12).
What are the key properties of 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine?
1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 209.28 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 14825379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).