About (Z,17R)-octadec-9-ene-1,17-diamine
(Z,17R)-octadec-9-ene-1,17-diamine (PubChem CID 14825482) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is (Z,17R)-octadec-9-ene-1,17-diamine.
Molecular Properties
| Compound Name | (Z,17R)-octadec-9-ene-1,17-diamine |
| PubChem CID | 14825482 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | (Z,17R)-octadec-9-ene-1,17-diamine |
| SMILES | C[C@@H](N)CCCCCC/C=C\CCCCCCCCN |
| InChI | InChI=1S/C18H38N2/c1-18(20)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19/h2,4,18H,3,5-17,19-20H2,1H3/b4-2-/t18-/m1/s1 |
| InChIKey | QQBIZOLJXFSVIO-HCABJEFNSA-N |
| XLogP | 4.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,17R)-octadec-9-ene-1,17-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,17R)-octadec-9-ene-1,17-diamine?
The IUPAC name of (Z,17R)-octadec-9-ene-1,17-diamine (CID 14825482) is (Z,17R)-octadec-9-ene-1,17-diamine.
What is the SMILES notation for (Z,17R)-octadec-9-ene-1,17-diamine?
The canonical SMILES for (Z,17R)-octadec-9-ene-1,17-diamine is C[C@@H](N)CCCCCC/C=C\CCCCCCCCN.
What is the InChIKey of (Z,17R)-octadec-9-ene-1,17-diamine?
The InChIKey is QQBIZOLJXFSVIO-HCABJEFNSA-N. The full InChI is InChI=1S/C18H38N2/c1-18(20)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19/h2,4,18H,3,5-17,19-20H2,1H3/b4-2-/t18-/m1/s1.
What are the key properties of (Z,17R)-octadec-9-ene-1,17-diamine?
(Z,17R)-octadec-9-ene-1,17-diamine has a molecular weight of 282.52 g/mol, XLogP of 4.92, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,17R)-octadec-9-ene-1,17-diamine is sourced from PubChem (CID 14825482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).