About (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone
(2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone (PubChem CID 1482558) has the molecular formula C16H9Cl2NOS
and a molecular weight of 334.23 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 1482558 |
| Molecular Formula | C16H9Cl2NOS |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2ccccc2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Cl2NOS/c17-11-6-7-12(13(18)8-11)15(20)14-9-19-16(21-14)10-4-2-1-3-5-10/h1-9H |
| InChIKey | QGNOPHAJQCWQFJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone?
The IUPAC name of (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone (CID 1482558) is (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone is O=C(c1cnc(-c2ccccc2)s1)c1ccc(Cl)cc1Cl.
What is the InChIKey of (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone?
The InChIKey is QGNOPHAJQCWQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl2NOS/c17-11-6-7-12(13(18)8-11)15(20)14-9-19-16(21-14)10-4-2-1-3-5-10/h1-9H.
What are the key properties of (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone?
(2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone has a molecular weight of 334.23 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)-(2-phenyl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 1482558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).