C12H11N3O2S — CID 1482794
cis-(4S,5R)-5-thiophen-2-yl-4-(1,2,4-triazol-1-yl)cyclohexane-1,3-dione (PubChem CID 1482794) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is cis-(4S,5R)-5-thiophen-2-yl-4-(1,2,4-triazol-1-yl)cyclohexane-1,3-dione.
| Compound Name | cis-(4S,5R)-5-thiophen-2-yl-4-(1,2,4-triazol-1-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 1482794 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | cis-(4S,5R)-5-thiophen-2-yl-4-(1,2,4-triazol-1-yl)cyclohexane-1,3-dione |
| SMILES | O=C1CC(=O)[C@@H](n2cncn2)[C@H](c2cccs2)C1 |
| InChI | InChI=1S/C12H11N3O2S/c16-8-4-9(11-2-1-3-18-11)12(10(17)5-8)15-7-13-6-14-15/h1-3,6-7,9,12H,4-5H2/t9-,12-/m0/s1 |
| InChIKey | YGCVEGMBOJDGIE-CABZTGNLSA-N |
| XLogP | 1.60 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|