About 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol
1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol (PubChem CID 14827985) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol.
Molecular Properties
| Compound Name | 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol |
| PubChem CID | 14827985 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol |
| SMILES | C=CC(O)C#CC#CC(O)C1OC1CCCCCCC |
| InChI | InChI=1S/C17H24O3/c1-3-5-6-7-8-13-16-17(20-16)15(19)12-10-9-11-14(18)4-2/h4,14-19H,2-3,5-8,13H2,1H3 |
| InChIKey | UJQVRPFUQYYCTH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol?
The IUPAC name of 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol (CID 14827985) is 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol.
What is the SMILES notation for 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol?
The canonical SMILES for 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol is C=CC(O)C#CC#CC(O)C1OC1CCCCCCC.
What is the InChIKey of 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol?
The InChIKey is UJQVRPFUQYYCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-3-5-6-7-8-13-16-17(20-16)15(19)12-10-9-11-14(18)4-2/h4,14-19H,2-3,5-8,13H2,1H3.
What are the key properties of 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol?
1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol has a molecular weight of 276.38 g/mol, XLogP of 2.03, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-heptyloxiran-2-yl)oct-7-en-2,4-diyne-1,6-diol is sourced from PubChem (CID 14827985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).