C17H16O3 — CID 14828176
7-propan-2-yl-3,4-dihydro-2H-phenanthrene-1,5,6-trione (PubChem CID 14828176) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 7-propan-2-yl-3,4-dihydro-2H-phenanthrene-1,5,6-trione.
| Compound Name | 7-propan-2-yl-3,4-dihydro-2H-phenanthrene-1,5,6-trione |
|---|---|
| PubChem CID | 14828176 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 7-propan-2-yl-3,4-dihydro-2H-phenanthrene-1,5,6-trione |
| SMILES | CC(C)C1=Cc2ccc3c(c2C(=O)C1=O)CCCC3=O |
| InChI | InChI=1S/C17H16O3/c1-9(2)13-8-10-6-7-11-12(4-3-5-14(11)18)15(10)17(20)16(13)19/h6-9H,3-5H2,1-2H3 |
| InChIKey | OFBWLFBAAKZPJH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|