About 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene
6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene (PubChem CID 14828178) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene.
Molecular Properties
| Compound Name | 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene |
| PubChem CID | 14828178 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene |
| SMILES | COc1cc2c3c(ccc2cc1C(C)C)C(C)=CCC3 |
| InChI | InChI=1S/C19H22O/c1-12(2)17-10-14-8-9-15-13(3)6-5-7-16(15)18(14)11-19(17)20-4/h6,8-12H,5,7H2,1-4H3 |
| InChIKey | WLKKRNAOTZEMJJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene?
The IUPAC name of 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene (CID 14828178) is 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene.
What is the SMILES notation for 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene?
The canonical SMILES for 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene is COc1cc2c3c(ccc2cc1C(C)C)C(C)=CCC3.
What is the InChIKey of 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene?
The InChIKey is WLKKRNAOTZEMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O/c1-12(2)17-10-14-8-9-15-13(3)6-5-7-16(15)18(14)11-19(17)20-4/h6,8-12H,5,7H2,1-4H3.
What are the key properties of 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene?
6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene has a molecular weight of 266.38 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1-methyl-7-propan-2-yl-3,4-dihydrophenanthrene is sourced from PubChem (CID 14828178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).