C13H13N3 — CID 14828218
3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine (PubChem CID 14828218) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine.
| Compound Name | 3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine |
|---|---|
| PubChem CID | 14828218 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine |
| SMILES | Nc1ncnc2c1CCCc1ccccc1-2 |
| InChI | InChI=1S/C13H13N3/c14-13-11-7-3-5-9-4-1-2-6-10(9)12(11)15-8-16-13/h1-2,4,6,8H,3,5,7H2,(H2,14,15,16) |
| InChIKey | AEXVRKDHZJXIMW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |