About [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate
[(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate (PubChem CID 1482825) has the molecular formula C14H15NO2S
and a molecular weight of 261.35 g/mol. Its IUPAC name is [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate |
| PubChem CID | 1482825 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate |
| SMILES | Cc1ccc2c(c1)C(=NOC(=O)C1CC1)CCS2 |
| InChI | InChI=1S/C14H15NO2S/c1-9-2-5-13-11(8-9)12(6-7-18-13)15-17-14(16)10-3-4-10/h2,5,8,10H,3-4,6-7H2,1H3 |
| InChIKey | GMONLGSYXOORBR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate?
The IUPAC name of [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate (CID 1482825) is [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate.
What is the SMILES notation for [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate?
The canonical SMILES for [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate is Cc1ccc2c(c1)C(=NOC(=O)C1CC1)CCS2.
What is the InChIKey of [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate?
The InChIKey is GMONLGSYXOORBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S/c1-9-2-5-13-11(8-9)12(6-7-18-13)15-17-14(16)10-3-4-10/h2,5,8,10H,3-4,6-7H2,1H3.
What are the key properties of [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate?
[(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate has a molecular weight of 261.35 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6-methyl-2,3-dihydrothiochromen-4-ylidene)amino] cyclopropanecarboxylate is sourced from PubChem (CID 1482825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).