C16H19N5O2 — CID 1482907
methyl (2S)-2-(10-cyano-7-methyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)-3-methylbutanoate (PubChem CID 1482907) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl (2S)-2-(10-cyano-7-methyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)-3-methylbutanoate.
| Compound Name | methyl (2S)-2-(10-cyano-7-methyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 1482907 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | methyl (2S)-2-(10-cyano-7-methyl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)-3-methylbutanoate |
| SMILES | COC(=O)[C@H](C(C)C)N1CCc2c(C)nc3c(C#N)cnn3c21 |
| InChI | InChI=1S/C16H19N5O2/c1-9(2)13(16(22)23-4)20-6-5-12-10(3)19-14-11(7-17)8-18-21(14)15(12)20/h8-9,13H,5-6H2,1-4H3/t13-/m0/s1 |
| InChIKey | PRQKYKYLDGVEFJ-ZDUSSCGKSA-N |
| XLogP | 1.47 |
| TPSA | 83.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |