About 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one
3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 1482909) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| PubChem CID | 1482909 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=C1CCn2ncc(-c3ccccc3)c2N1 |
| InChI | InChI=1S/C12H11N3O/c16-11-6-7-15-12(14-11)10(8-13-15)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,14,16) |
| InChIKey | WUSBRVHIYOCSKN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The IUPAC name of 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one (CID 1482909) is 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one.
What is the SMILES notation for 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The canonical SMILES for 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one is O=C1CCn2ncc(-c3ccccc3)c2N1.
What is the InChIKey of 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The InChIKey is WUSBRVHIYOCSKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c16-11-6-7-15-12(14-11)10(8-13-15)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,14,16).
What are the key properties of 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one?
3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one has a molecular weight of 213.24 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrimidin-5-one is sourced from PubChem (CID 1482909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).