About 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide
5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide (PubChem CID 1482920) has the molecular formula C16H19ClN4O2
and a molecular weight of 334.81 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide |
| PubChem CID | 1482920 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)CNC(=O)c2c(C)nn(C)c2Cl)cc1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-10-4-6-12(7-5-10)8-18-13(22)9-19-16(23)14-11(2)20-21(3)15(14)17/h4-7H,8-9H2,1-3H3,(H,18,22)(H,19,23) |
| InChIKey | BRMCRQZODCKXKU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide?
The IUPAC name of 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide (CID 1482920) is 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide.
What is the SMILES notation for 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide?
The canonical SMILES for 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide is Cc1ccc(CNC(=O)CNC(=O)c2c(C)nn(C)c2Cl)cc1.
What is the InChIKey of 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide?
The InChIKey is BRMCRQZODCKXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O2/c1-10-4-6-12(7-5-10)8-18-13(22)9-19-16(23)14-11(2)20-21(3)15(14)17/h4-7H,8-9H2,1-3H3,(H,18,22)(H,19,23).
What are the key properties of 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide?
5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide has a molecular weight of 334.81 g/mol, XLogP of 1.74, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-dimethyl-N-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]pyrazole-4-carboxamide is sourced from PubChem (CID 1482920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).