C18H26O2 — CID 14829894
5-(methoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]methyl]cyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 14829894) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 5-(methoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]methyl]cyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | 5-(methoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]methyl]cyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 14829894 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5-(methoxymethyl)-5-[[(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclopentyl]methyl]cyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@H]1CC1(COC)C=CC=C1C=O |
| InChI | InChI=1S/C18H26O2/c1-13(2)16-8-7-14(3)17(16)10-18(12-20-4)9-5-6-15(18)11-19/h5-6,9,11,14,16-17H,1,7-8,10,12H2,2-4H3/t14-,16+,17-,18?/m1/s1 |
| InChIKey | AQVASNAQPBYZNF-JSWLAIEMSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|