About methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate
methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate (PubChem CID 1483017) has the molecular formula C14H12Cl2N2O3
and a molecular weight of 327.17 g/mol. Its IUPAC name is methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate |
| PubChem CID | 1483017 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1ccc(=O)n(Cc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-21-14(20)17-9-5-6-13(19)18(7-9)8-10-11(15)3-2-4-12(10)16/h2-7H,8H2,1H3,(H,17,20) |
| InChIKey | VOARYOHPFVQNSX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate?
The IUPAC name of methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate (CID 1483017) is methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate.
What is the SMILES notation for methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate?
The canonical SMILES for methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate is COC(=O)Nc1ccc(=O)n(Cc2c(Cl)cccc2Cl)c1.
What is the InChIKey of methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate?
The InChIKey is VOARYOHPFVQNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N2O3/c1-21-14(20)17-9-5-6-13(19)18(7-9)8-10-11(15)3-2-4-12(10)16/h2-7H,8H2,1H3,(H,17,20).
What are the key properties of methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate?
methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate has a molecular weight of 327.17 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-[(2,6-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]carbamate is sourced from PubChem (CID 1483017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).