About (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate
(4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 14830207) has the molecular formula C17H23N3O5S
and a molecular weight of 381.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate |
| PubChem CID | 14830207 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=O)CC[C@@H]1C[C@H](S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H23N3O5S/c1-18(2)16(21)8-7-14-9-15(26)10-19(14)17(22)25-11-12-3-5-13(6-4-12)20(23)24/h3-6,14-15,26H,7-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | YLRWFFWCIWFONC-CABCVRRESA-N |
| XLogP | 2.47 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate?
The IUPAC name of (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate (CID 14830207) is (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate.
What is the SMILES notation for (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate?
The canonical SMILES for (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate is CN(C)C(=O)CC[C@@H]1C[C@H](S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate?
The InChIKey is YLRWFFWCIWFONC-CABCVRRESA-N. The full InChI is InChI=1S/C17H23N3O5S/c1-18(2)16(21)8-7-14-9-15(26)10-19(14)17(22)25-11-12-3-5-13(6-4-12)20(23)24/h3-6,14-15,26H,7-11H2,1-2H3/t14-,15+/m1/s1.
What are the key properties of (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate?
(4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate has a molecular weight of 381.45 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl (2R,4S)-2-[3-(dimethylamino)-3-oxopropyl]-4-sulfanylpyrrolidine-1-carboxylate is sourced from PubChem (CID 14830207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).