About 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide
4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide (PubChem CID 1483025) has the molecular formula C18H13Cl3N2O3S
and a molecular weight of 443.74 g/mol. Its IUPAC name is 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide |
| PubChem CID | 1483025 |
| Molecular Formula | C18H13Cl3N2O3S |
| Molecular Weight | 443.74 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide |
| SMILES | O=c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl3N2O3S/c19-13-2-5-15(6-3-13)27(25,26)22-14-4-8-18(24)23(11-14)10-12-1-7-16(20)17(21)9-12/h1-9,11,22H,10H2 |
| InChIKey | MNPLIUSEUITYQS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide?
The IUPAC name of 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide (CID 1483025) is 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide.
What is the SMILES notation for 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide?
The canonical SMILES for 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide is O=c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cn1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide?
The InChIKey is MNPLIUSEUITYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl3N2O3S/c19-13-2-5-15(6-3-13)27(25,26)22-14-4-8-18(24)23(11-14)10-12-1-7-16(20)17(21)9-12/h1-9,11,22H,10H2.
What are the key properties of 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide?
4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide has a molecular weight of 443.74 g/mol, XLogP of 4.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]benzenesulfonamide is sourced from PubChem (CID 1483025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).