About (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene
(4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene (PubChem CID 14830703) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene.
Molecular Properties
| Compound Name | (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene |
| PubChem CID | 14830703 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene |
| SMILES | CC1=CC[C@](C)(C2=CCCC2(C)C)CC1 |
| InChI | InChI=1S/C15H24/c1-12-7-10-15(4,11-8-12)13-6-5-9-14(13,2)3/h6-7H,5,8-11H2,1-4H3/t15-/m0/s1 |
| InChIKey | WUOZOSFJWTXTKG-HNNXBMFYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene?
The IUPAC name of (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene (CID 14830703) is (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene.
What is the SMILES notation for (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene?
The canonical SMILES for (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene is CC1=CC[C@](C)(C2=CCCC2(C)C)CC1.
What is the InChIKey of (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene?
The InChIKey is WUOZOSFJWTXTKG-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H24/c1-12-7-10-15(4,11-8-12)13-6-5-9-14(13,2)3/h6-7H,5,8-11H2,1-4H3/t15-/m0/s1.
What are the key properties of (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene?
(4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene has a molecular weight of 204.36 g/mol, XLogP of 4.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(5,5-dimethylcyclopenten-1-yl)-1,4-dimethylcyclohexene is sourced from PubChem (CID 14830703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).