C17H26O4 — CID 14830717
(3aR,7S,8aR)-6-(3,3-dimethoxybutyl)-7-methyl-3-methylidene-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one (PubChem CID 14830717) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3aR,7S,8aR)-6-(3,3-dimethoxybutyl)-7-methyl-3-methylidene-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one.
| Compound Name | (3aR,7S,8aR)-6-(3,3-dimethoxybutyl)-7-methyl-3-methylidene-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 14830717 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (3aR,7S,8aR)-6-(3,3-dimethoxybutyl)-7-methyl-3-methylidene-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2C[C@H](C)C(CCC(C)(OC)OC)=CC[C@H]12 |
| InChI | InChI=1S/C17H26O4/c1-11-10-15-14(12(2)16(18)21-15)7-6-13(11)8-9-17(3,19-4)20-5/h6,11,14-15H,2,7-10H2,1,3-5H3/t11-,14+,15+/m0/s1 |
| InChIKey | BIYCTLMIEJRIEX-NILFDRSVSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|