About 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione
1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione (PubChem CID 14830724) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione.
Molecular Properties
| Compound Name | 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione |
| PubChem CID | 14830724 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione |
| SMILES | CC(C)=CC(=O)CC(C)(O)CCC(=O)c1ccoc1 |
| InChI | InChI=1S/C15H20O4/c1-11(2)8-13(16)9-15(3,18)6-4-14(17)12-5-7-19-10-12/h5,7-8,10,18H,4,6,9H2,1-3H3 |
| InChIKey | GENURIBYATWERM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione?
The IUPAC name of 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione (CID 14830724) is 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione.
What is the SMILES notation for 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione?
The canonical SMILES for 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione is CC(C)=CC(=O)CC(C)(O)CCC(=O)c1ccoc1.
What is the InChIKey of 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione?
The InChIKey is GENURIBYATWERM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-11(2)8-13(16)9-15(3,18)6-4-14(17)12-5-7-19-10-12/h5,7-8,10,18H,4,6,9H2,1-3H3.
What are the key properties of 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione?
1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione has a molecular weight of 264.32 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-yl)-4-hydroxy-4,8-dimethylnon-7-ene-1,6-dione is sourced from PubChem (CID 14830724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).