C17H24O3 — CID 14830794
[(2E)-2-[(8S,8aR)-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalen-2-ylidene]propyl] acetate (PubChem CID 14830794) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(2E)-2-[(8S,8aR)-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalen-2-ylidene]propyl] acetate.
| Compound Name | [(2E)-2-[(8S,8aR)-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalen-2-ylidene]propyl] acetate |
|---|---|
| PubChem CID | 14830794 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(2E)-2-[(8S,8aR)-8,8a-dimethyl-3-oxo-5,6,7,8-tetrahydro-1H-naphthalen-2-ylidene]propyl] acetate |
| SMILES | CC(=O)OC/C(C)=C1\C[C@@]2(C)C(=CC1=O)CCC[C@@H]2C |
| InChI | InChI=1S/C17H24O3/c1-11(10-20-13(3)18)15-9-17(4)12(2)6-5-7-14(17)8-16(15)19/h8,12H,5-7,9-10H2,1-4H3/b15-11+/t12-,17+/m0/s1 |
| InChIKey | CEWBGSRDSZRHHJ-PVPZKTMUSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|